Hangzhou Jinlan Pharm-Drugs Technology Co. Ltd.(JL Pharm) is an advanced pharmaceutical corporation with a laboratory of 1200 square meters in Nanjing city, and cooperative GMP production plants in Beljing, Jiangsu, Zhejiang, Jiangxi, Chengdrand Shandong.We can provide both CDMO technology research and development services, and a ful range of laboratory R&D and production services for raw materials and pharmaceutical intermediates to globapharmaceutical companies during which synthetic route research and development, process reearch and development and optimization, scale-up production, domestic and foreign drug registration, and industrial equipment selection, automatic control system and technical process packages.
Product Name: AcetaMide, 2-[[bis(4-fluorophenyl)Methyl]sulfinyl]-N-hydroxy-
Synonyms:
AcetaMide, 2-[[bis(4-fluorophenyl)Methyl]sulfinyl]-N-hydroxy-;
2-[bis(4-fluorophenyl)Methyl]sulfinylethanehydroxaMic acid;
Fladrafinil;
Fladrafinil (Bisfluoroadrafinil);
2-[[Bis(4-fluorophenyl)methyl]sulfinyl]-N-hydroxyacetamide;
CRL-40,941;
Fladrafinil, Bisfluroadrafinil;
Nootropic fluorafinil\/CRL-40.941
| CAS: |
90212-80-9 |
| MF: |
C15H13F2NO3S |
| MW: |
325.33 |
| EINECS: |
|
| Product Categories: |
|
| Mol File: |
90212-80-9.mol |
![Acetamide, 2-[[Bis (4-fluorophenyl) Methyl]Sulfinyl]-N-Hydroxy- 90212-80-9](//www.micstatic.com/athena/img/transparent.png)
| Melting point |
>102°C (dec.) |
| density |
1.452±0.06 g/cm3(Predicted) |
| storage temp. |
-20°C Freezer |
| solubility |
DMSO (Slightly), Methano (Slightly) |
| pka |
8.18±0.20(Predicted) |
| form |
Solid |
| color |
White |
| InChI |
InChI=1S/C15H13F2NO3S/c16-12-5-1-10(2-6-12)15(22(21)9-14(19)18-20)11-3-7-13(17)8-4-11/h1-8,15,20H,9H2,(H,18,19) |
| InChIKey |
VKGUUSVYPXTWMA-UHFFFAOYSA-N |
| SMILES |
C(NO)(=O)CS(C(C1=CC=C(F)C=C1)C1=CC=C(F)C=C1)=O |
Audited Supplier ![Acetamide, 2-[[Bis (4-fluorophenyl) Methyl]Sulfinyl]-N-Hydroxy- 90212-80-9](http://www.micstatic.com/athena/img/transparent.png)
){kind=link}
){kind=link}